C15H10ClN3O — CID 11231429
6-(4-chlorophenyl)-4-oxido-3-phenyl-1,2,4-triazin-4-ium (PubChem CID 11231429) has the molecular formula C15H10ClN3O and a molecular weight of 283.72 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-4-oxido-3-phenyl-1,2,4-triazin-4-ium.
| Compound Name | 6-(4-chlorophenyl)-4-oxido-3-phenyl-1,2,4-triazin-4-ium |
|---|---|
| PubChem CID | 11231429 |
| Molecular Formula | C15H10ClN3O |
| Molecular Weight | 283.72 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | 6-(4-chlorophenyl)-4-oxido-3-phenyl-1,2,4-triazin-4-ium |
| SMILES | [O-][n+]1cc(-c2ccc(Cl)cc2)nnc1-c1ccccc1 |
| InChI | InChI=1S/C15H10ClN3O/c16-13-8-6-11(7-9-13)14-10-19(20)15(18-17-14)12-4-2-1-3-5-12/h1-10H |
| InChIKey | WSTMYVLSIBKOSC-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 52.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.72 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|