C23H30O5 — CID 11234557
11-(2-hydroxyphenyl)-1-(2,4,6-trihydroxyphenyl)undecan-1-one (PubChem CID 11234557) has the molecular formula C23H30O5 and a molecular weight of 386.49 g/mol. Its IUPAC name is 11-(2-hydroxyphenyl)-1-(2,4,6-trihydroxyphenyl)undecan-1-one.
| Compound Name | 11-(2-hydroxyphenyl)-1-(2,4,6-trihydroxyphenyl)undecan-1-one |
|---|---|
| PubChem CID | 11234557 |
| Molecular Formula | C23H30O5 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | 11-(2-hydroxyphenyl)-1-(2,4,6-trihydroxyphenyl)undecan-1-one |
| SMILES | O=C(CCCCCCCCCCc1ccccc1O)c1c(O)cc(O)cc1O |
| InChI | InChI=1S/C23H30O5/c24-18-15-21(27)23(22(28)16-18)20(26)14-8-6-4-2-1-3-5-7-11-17-12-9-10-13-19(17)25/h9-10,12-13,15-16,24-25,27-28H,1-8,11,14H2 |
| InChIKey | KRAWWRGYJVWEDK-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|