C42H50O8 — CID 127052219
1-[3-[2-[9-(2,6-dihydroxyphenyl)-9-oxononyl]-4,5-dihydroxyphenyl]-2,6-dihydroxyphenyl]-9-phenylnonan-1-one (PubChem CID 127052219) has the molecular formula C42H50O8 and a molecular weight of 682.85 g/mol. Its IUPAC name is 1-[3-[2-[9-(2,6-dihydroxyphenyl)-9-oxononyl]-4,5-dihydroxyphenyl]-2,6-dihydroxyphenyl]-9-phenylnonan-1-one.
| Compound Name | 1-[3-[2-[9-(2,6-dihydroxyphenyl)-9-oxononyl]-4,5-dihydroxyphenyl]-2,6-dihydroxyphenyl]-9-phenylnonan-1-one |
|---|---|
| PubChem CID | 127052219 |
| Molecular Formula | C42H50O8 |
| Molecular Weight | 682.85 g/mol |
| Exact Mass | 682.35 |
| IUPAC Name | 1-[3-[2-[9-(2,6-dihydroxyphenyl)-9-oxononyl]-4,5-dihydroxyphenyl]-2,6-dihydroxyphenyl]-9-phenylnonan-1-one |
| SMILES | O=C(CCCCCCCCc1cc(O)c(O)cc1-c1ccc(O)c(C(=O)CCCCCCCCc2ccccc2)c1O)c1c(O)cccc1O |
| InChI | InChI=1S/C42H50O8/c43-33(40-34(44)23-16-24-35(40)45)21-14-7-4-2-6-13-20-30-27-38(48)39(49)28-32(30)31-25-26-37(47)41(42(31)50)36(46)22-15-8-3-1-5-10-17-29-18-11-9-12-19-29/h9,11-12,16,18-19,23-28,44-45,47-50H,1-8,10,13-15,17,20-22H2 |
| InChIKey | UFSHFPYNWSGTKQ-UHFFFAOYSA-N |
| XLogP | 9.90 |
| TPSA | 155.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.85 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|