C24H32F3NO6 — CID 11237131
tert-butyl (E,2S)-5-[(4R,5R)-2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolan-4-yl]-2-[(2,2,2-trifluoroacetyl)amino]pent-4-enoate (PubChem CID 11237131) has the molecular formula C24H32F3NO6 and a molecular weight of 487.52 g/mol. Its IUPAC name is tert-butyl (E,2S)-5-[(4R,5R)-2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolan-4-yl]-2-[(2,2,2-trifluoroacetyl)amino]pent-4-enoate.
| Compound Name | tert-butyl (E,2S)-5-[(4R,5R)-2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolan-4-yl]-2-[(2,2,2-trifluoroacetyl)amino]pent-4-enoate |
|---|---|
| PubChem CID | 11237131 |
| Molecular Formula | C24H32F3NO6 |
| Molecular Weight | 487.52 g/mol |
| Exact Mass | 487.22 |
| IUPAC Name | tert-butyl (E,2S)-5-[(4R,5R)-2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolan-4-yl]-2-[(2,2,2-trifluoroacetyl)amino]pent-4-enoate |
| SMILES | CC(C)(C)OC(=O)[C@H](C/C=C/[C@H]1OC(C)(C)O[C@@H]1COCc1ccccc1)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C24H32F3NO6/c1-22(2,3)34-20(29)17(28-21(30)24(25,26)27)12-9-13-18-19(33-23(4,5)32-18)15-31-14-16-10-7-6-8-11-16/h6-11,13,17-19H,12,14-15H2,1-5H3,(H,28,30)/b13-9+/t17-,18+,19+/m0/s1 |
| InChIKey | PBVFVUVFQUWPNY-ZOYKTYNSSA-N |
| XLogP | 4.06 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.52 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|