C13H25NO6 — CID 11243272
ethyl 2-[(2S,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)-1-propylpiperidin-2-yl]acetate (PubChem CID 11243272) has the molecular formula C13H25NO6 and a molecular weight of 291.34 g/mol. Its IUPAC name is ethyl 2-[(2S,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)-1-propylpiperidin-2-yl]acetate.
| Compound Name | ethyl 2-[(2S,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)-1-propylpiperidin-2-yl]acetate |
|---|---|
| PubChem CID | 11243272 |
| Molecular Formula | C13H25NO6 |
| Molecular Weight | 291.34 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | ethyl 2-[(2S,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)-1-propylpiperidin-2-yl]acetate |
| SMILES | CCCN1[C@@H](CC(=O)OCC)[C@H](O)[C@@H](O)[C@H](O)[C@@H]1CO |
| InChI | InChI=1S/C13H25NO6/c1-3-5-14-8(6-10(16)20-4-2)11(17)13(19)12(18)9(14)7-15/h8-9,11-13,15,17-19H,3-7H2,1-2H3/t8-,9-,11-,12+,13+/m0/s1 |
| InChIKey | UWJAVWXZWCLGOC-XZPDDHLCSA-N |
| XLogP | -1.52 |
| TPSA | 110.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.34 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |