C14H10F2N2O4 — CID 11243751
2-(2,4-difluoroanilino)-2-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)acetonitrile (PubChem CID 11243751) has the molecular formula C14H10F2N2O4 and a molecular weight of 308.24 g/mol. Its IUPAC name is 2-(2,4-difluoroanilino)-2-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)acetonitrile.
| Compound Name | 2-(2,4-difluoroanilino)-2-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)acetonitrile |
|---|---|
| PubChem CID | 11243751 |
| Molecular Formula | C14H10F2N2O4 |
| Molecular Weight | 308.24 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 2-(2,4-difluoroanilino)-2-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)acetonitrile |
| SMILES | CC1(C)OC(=O)C(=C(C#N)Nc2ccc(F)cc2F)C(=O)O1 |
| InChI | InChI=1S/C14H10F2N2O4/c1-14(2)21-12(19)11(13(20)22-14)10(6-17)18-9-4-3-7(15)5-8(9)16/h3-5,18H,1-2H3 |
| InChIKey | DOOFCMWSIKSIKA-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.24 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|