C18H16OSSe — CID 11245320
(2E,4E)-3-methylsulfanyl-5-phenyl-4-phenylselanylpenta-2,4-dienal (PubChem CID 11245320) has the molecular formula C18H16OSSe and a molecular weight of 359.35 g/mol. Its IUPAC name is (2E,4E)-3-methylsulfanyl-5-phenyl-4-phenylselanylpenta-2,4-dienal.
| Compound Name | (2E,4E)-3-methylsulfanyl-5-phenyl-4-phenylselanylpenta-2,4-dienal |
|---|---|
| PubChem CID | 11245320 |
| Molecular Formula | C18H16OSSe |
| Molecular Weight | 359.35 g/mol |
| Exact Mass | 360.01 |
| IUPAC Name | (2E,4E)-3-methylsulfanyl-5-phenyl-4-phenylselanylpenta-2,4-dienal |
| SMILES | CSC(=C/C=O)/C(=C\c1ccccc1)[Se]c1ccccc1 |
| InChI | InChI=1S/C18H16OSSe/c1-20-17(12-13-19)18(14-15-8-4-2-5-9-15)21-16-10-6-3-7-11-16/h2-14H,1H3/b17-12+,18-14+ |
| InChIKey | SQSZXFCNSXTKJU-NXGXIAAHSA-N |
| XLogP | 3.50 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.35 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|