C23H18OSSe — CID 11212340
(2Z,4Z)-5-phenyl-4-phenylselanyl-3-phenylsulfanylpenta-2,4-dienal (PubChem CID 11212340) has the molecular formula C23H18OSSe and a molecular weight of 421.42 g/mol. Its IUPAC name is (2Z,4Z)-5-phenyl-4-phenylselanyl-3-phenylsulfanylpenta-2,4-dienal.
| Compound Name | (2Z,4Z)-5-phenyl-4-phenylselanyl-3-phenylsulfanylpenta-2,4-dienal |
|---|---|
| PubChem CID | 11212340 |
| Molecular Formula | C23H18OSSe |
| Molecular Weight | 421.42 g/mol |
| Exact Mass | 422.02 |
| IUPAC Name | (2Z,4Z)-5-phenyl-4-phenylselanyl-3-phenylsulfanylpenta-2,4-dienal |
| SMILES | O=C/C=C(Sc1ccccc1)/C(=C/c1ccccc1)[Se]c1ccccc1 |
| InChI | InChI=1S/C23H18OSSe/c24-17-16-22(25-20-12-6-2-7-13-20)23(18-19-10-4-1-5-11-19)26-21-14-8-3-9-15-21/h1-18H/b22-16-,23-18- |
| InChIKey | XSZNFSAJSKLNRH-NEEBWFLQSA-N |
| XLogP | 4.93 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.42 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|