C25H20OSSe — CID 11465022
(2E,4Z,6E)-7-phenyl-4-phenylselanyl-3-phenylsulfanylhepta-2,4,6-trienal (PubChem CID 11465022) has the molecular formula C25H20OSSe and a molecular weight of 447.46 g/mol. Its IUPAC name is (2E,4Z,6E)-7-phenyl-4-phenylselanyl-3-phenylsulfanylhepta-2,4,6-trienal.
| Compound Name | (2E,4Z,6E)-7-phenyl-4-phenylselanyl-3-phenylsulfanylhepta-2,4,6-trienal |
|---|---|
| PubChem CID | 11465022 |
| Molecular Formula | C25H20OSSe |
| Molecular Weight | 447.46 g/mol |
| Exact Mass | 448.04 |
| IUPAC Name | (2E,4Z,6E)-7-phenyl-4-phenylselanyl-3-phenylsulfanylhepta-2,4,6-trienal |
| SMILES | O=C/C=C(Sc1ccccc1)\C(=C\C=C\c1ccccc1)[Se]c1ccccc1 |
| InChI | InChI=1S/C25H20OSSe/c26-20-19-24(27-22-14-6-2-7-15-22)25(28-23-16-8-3-9-17-23)18-10-13-21-11-4-1-5-12-21/h1-20H/b13-10+,24-19+,25-18- |
| InChIKey | UVHWRVMAKVAIKW-FQRXOZEQSA-N |
| XLogP | 5.49 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.46 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|