C19H28N2O6Si — CID 11246818
1-[(4aR,6R,7R,7aS)-2,2-ditert-butyl-6-ethynyl-7-hydroxy-4,4a,7,7a-tetrahydrofuro[3,2-d][1,3,2]dioxasilin-6-yl]pyrimidine-2,4-dione (PubChem CID 11246818) has the molecular formula C19H28N2O6Si and a molecular weight of 408.53 g/mol. Its IUPAC name is 1-[(4aR,6R,7R,7aS)-2,2-ditert-butyl-6-ethynyl-7-hydroxy-4,4a,7,7a-tetrahydrofuro[3,2-d][1,3,2]dioxasilin-6-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(4aR,6R,7R,7aS)-2,2-ditert-butyl-6-ethynyl-7-hydroxy-4,4a,7,7a-tetrahydrofuro[3,2-d][1,3,2]dioxasilin-6-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 11246818 |
| Molecular Formula | C19H28N2O6Si |
| Molecular Weight | 408.53 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 1-[(4aR,6R,7R,7aS)-2,2-ditert-butyl-6-ethynyl-7-hydroxy-4,4a,7,7a-tetrahydrofuro[3,2-d][1,3,2]dioxasilin-6-yl]pyrimidine-2,4-dione |
| SMILES | C#C[C@@]1(n2ccc(=O)[nH]c2=O)O[C@@H]2CO[Si](C(C)(C)C)(C(C)(C)C)O[C@H]2[C@H]1O |
| InChI | InChI=1S/C19H28N2O6Si/c1-8-19(21-10-9-13(22)20-16(21)24)15(23)14-12(26-19)11-25-28(27-14,17(2,3)4)18(5,6)7/h1,9-10,12,14-15,23H,11H2,2-7H3,(H,20,22,24)/t12-,14-,15-,19-/m1/s1 |
| InChIKey | WKONGGVWRLUOSE-QEPJRFBGSA-N |
| XLogP | 1.04 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.53 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|