C19H32N2O6SSi — CID 102233629
1-[(4aR,6R,7R,7aR)-2,2-ditert-butyl-7-(methylsulfanylmethoxy)-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxasilin-6-yl]pyrimidine-2,4-dione (PubChem CID 102233629) has the molecular formula C19H32N2O6SSi and a molecular weight of 444.63 g/mol. Its IUPAC name is 1-[(4aR,6R,7R,7aR)-2,2-ditert-butyl-7-(methylsulfanylmethoxy)-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxasilin-6-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(4aR,6R,7R,7aR)-2,2-ditert-butyl-7-(methylsulfanylmethoxy)-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxasilin-6-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 102233629 |
| Molecular Formula | C19H32N2O6SSi |
| Molecular Weight | 444.63 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | 1-[(4aR,6R,7R,7aR)-2,2-ditert-butyl-7-(methylsulfanylmethoxy)-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxasilin-6-yl]pyrimidine-2,4-dione |
| SMILES | CSCO[C@@H]1[C@@H]2O[Si](C(C)(C)C)(C(C)(C)C)OC[C@H]2O[C@H]1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C19H32N2O6SSi/c1-18(2,3)29(19(4,5)6)25-10-12-14(27-29)15(24-11-28-7)16(26-12)21-9-8-13(22)20-17(21)23/h8-9,12,14-16H,10-11H2,1-7H3,(H,20,22,23)/t12-,14-,15-,16-/m1/s1 |
| InChIKey | WPJRLRBLBSYVPO-DTZQCDIJSA-N |
| XLogP | 2.60 |
| TPSA | 91.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.63 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|