C24H21N5O4 — CID 11247748
1-N-(4-ethynylphenyl)-4-hydroxy-2-N-[4-(2-oxo-1-pyridinyl)phenyl]pyrazolidine-1,2-dicarboxamide (PubChem CID 11247748) has the molecular formula C24H21N5O4 and a molecular weight of 443.46 g/mol. Its IUPAC name is 1-N-(4-ethynylphenyl)-4-hydroxy-2-N-[4-(2-oxo-1-pyridinyl)phenyl]pyrazolidine-1,2-dicarboxamide.
| Compound Name | 1-N-(4-ethynylphenyl)-4-hydroxy-2-N-[4-(2-oxo-1-pyridinyl)phenyl]pyrazolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 11247748 |
| Molecular Formula | C24H21N5O4 |
| Molecular Weight | 443.46 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | 1-N-(4-ethynylphenyl)-4-hydroxy-2-N-[4-(2-oxo-1-pyridinyl)phenyl]pyrazolidine-1,2-dicarboxamide |
| SMILES | C#Cc1ccc(NC(=O)N2CC(O)CN2C(=O)Nc2ccc(-n3ccccc3=O)cc2)cc1 |
| InChI | InChI=1S/C24H21N5O4/c1-2-17-6-8-18(9-7-17)25-23(32)28-15-21(30)16-29(28)24(33)26-19-10-12-20(13-11-19)27-14-4-3-5-22(27)31/h1,3-14,21,30H,15-16H2,(H,25,32)(H,26,33) |
| InChIKey | JZHGFLVQQLCHQK-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 106.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.46 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|