C24H22N4O5S — CID 85435465
2-[(4-ethynylphenyl)carbamoylamino]-3-methylsulfonyl-N-[4-(2-oxo-1-pyridinyl)phenyl]propanamide (PubChem CID 85435465) has the molecular formula C24H22N4O5S and a molecular weight of 478.53 g/mol. Its IUPAC name is 2-[(4-ethynylphenyl)carbamoylamino]-3-methylsulfonyl-N-[4-(2-oxo-1-pyridinyl)phenyl]propanamide.
| Compound Name | 2-[(4-ethynylphenyl)carbamoylamino]-3-methylsulfonyl-N-[4-(2-oxo-1-pyridinyl)phenyl]propanamide |
|---|---|
| PubChem CID | 85435465 |
| Molecular Formula | C24H22N4O5S |
| Molecular Weight | 478.53 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | 2-[(4-ethynylphenyl)carbamoylamino]-3-methylsulfonyl-N-[4-(2-oxo-1-pyridinyl)phenyl]propanamide |
| SMILES | C#Cc1ccc(NC(=O)NC(CS(C)(=O)=O)C(=O)Nc2ccc(-n3ccccc3=O)cc2)cc1 |
| InChI | InChI=1S/C24H22N4O5S/c1-3-17-7-9-19(10-8-17)26-24(31)27-21(16-34(2,32)33)23(30)25-18-11-13-20(14-12-18)28-15-5-4-6-22(28)29/h1,4-15,21H,16H2,2H3,(H,25,30)(H2,26,27,31) |
| InChIKey | UMATVRHJBSXKQL-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 126.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.53 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|