C28H36O4SSi — CID 11248992
tert-butyl-diphenyl-[[(1S,3R,5S,7R,9R,12R)-2,6,15-trioxa-11-thiatetracyclo[7.6.0.01,12.03,7]pentadecan-5-yl]methoxy]silane (PubChem CID 11248992) has the molecular formula C28H36O4SSi and a molecular weight of 496.75 g/mol. Its IUPAC name is tert-butyl-diphenyl-[[(1S,3R,5S,7R,9R,12R)-2,6,15-trioxa-11-thiatetracyclo[7.6.0.01,12.03,7]pentadecan-5-yl]methoxy]silane.
| Compound Name | tert-butyl-diphenyl-[[(1S,3R,5S,7R,9R,12R)-2,6,15-trioxa-11-thiatetracyclo[7.6.0.01,12.03,7]pentadecan-5-yl]methoxy]silane |
|---|---|
| PubChem CID | 11248992 |
| Molecular Formula | C28H36O4SSi |
| Molecular Weight | 496.75 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | tert-butyl-diphenyl-[[(1S,3R,5S,7R,9R,12R)-2,6,15-trioxa-11-thiatetracyclo[7.6.0.01,12.03,7]pentadecan-5-yl]methoxy]silane |
| SMILES | CC(C)(C)[Si](OC[C@@H]1C[C@H]2O[C@]34OCC[C@H]3SC[C@@H]4C[C@H]2O1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H36O4SSi/c1-27(2,3)34(22-10-6-4-7-11-22,23-12-8-5-9-13-23)30-18-21-17-25-24(31-21)16-20-19-33-26-14-15-29-28(20,26)32-25/h4-13,20-21,24-26H,14-19H2,1-3H3/t20-,21-,24+,25+,26+,28-/m0/s1 |
| InChIKey | GMUWGHKAYYXBCD-ZFKYYPKESA-N |
| XLogP | 4.36 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.75 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|