C27H38O4SSi — CID 91229375
[(3aR,7S,7aR)-2,2,7-trimethyl-6-methylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methoxy-tert-butyl-diphenylsilane (PubChem CID 91229375) has the molecular formula C27H38O4SSi and a molecular weight of 486.75 g/mol. Its IUPAC name is [(3aR,7S,7aR)-2,2,7-trimethyl-6-methylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methoxy-tert-butyl-diphenylsilane.
| Compound Name | [(3aR,7S,7aR)-2,2,7-trimethyl-6-methylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 91229375 |
| Molecular Formula | C27H38O4SSi |
| Molecular Weight | 486.75 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | [(3aR,7S,7aR)-2,2,7-trimethyl-6-methylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methoxy-tert-butyl-diphenylsilane |
| SMILES | CSC1OC(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H]2OC(C)(C)O[C@@H]2[C@@H]1C |
| InChI | InChI=1S/C27H38O4SSi/c1-19-23-24(31-27(5,6)30-23)22(29-25(19)32-7)18-28-33(26(2,3)4,20-14-10-8-11-15-20)21-16-12-9-13-17-21/h8-17,19,22-25H,18H2,1-7H3/t19-,22?,23+,24-,25?/m0/s1 |
| InChIKey | BNKFRCKLPXWADQ-KBESHWPGSA-N |
| XLogP | 4.81 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.75 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|