C40H48O6SSi — CID 135054608
tert-butyl-diphenyl-[[(5'S,9'R,12'R)-2-(phenylmethoxymethyl)spiro[2,3-dihydropyran-6,14'-2,6,15-trioxa-11-thiatetracyclo[7.6.0.01,12.03,7]pentadecane]-5'-yl]methoxy]silane (PubChem CID 135054608) has the molecular formula C40H48O6SSi and a molecular weight of 684.97 g/mol. Its IUPAC name is tert-butyl-diphenyl-[[(5'S,9'R,12'R)-2-(phenylmethoxymethyl)spiro[2,3-dihydropyran-6,14'-2,6,15-trioxa-11-thiatetracyclo[7.6.0.01,12.03,7]pentadecane]-5'-yl]methoxy]silane.
| Compound Name | tert-butyl-diphenyl-[[(5'S,9'R,12'R)-2-(phenylmethoxymethyl)spiro[2,3-dihydropyran-6,14'-2,6,15-trioxa-11-thiatetracyclo[7.6.0.01,12.03,7]pentadecane]-5'-yl]methoxy]silane |
|---|---|
| PubChem CID | 135054608 |
| Molecular Formula | C40H48O6SSi |
| Molecular Weight | 684.97 g/mol |
| Exact Mass | 684.29 |
| IUPAC Name | tert-butyl-diphenyl-[[(5'S,9'R,12'R)-2-(phenylmethoxymethyl)spiro[2,3-dihydropyran-6,14'-2,6,15-trioxa-11-thiatetracyclo[7.6.0.01,12.03,7]pentadecane]-5'-yl]methoxy]silane |
| SMILES | CC(C)(C)[Si](OC[C@@H]1CC2OC34OC5(C=CCC(COCc6ccccc6)O5)C[C@H]3SCC4CC2O1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C40H48O6SSi/c1-38(2,3)48(33-17-9-5-10-18-33,34-19-11-6-12-20-34)42-27-32-23-36-35(43-32)22-30-28-47-37-24-39(46-40(30,37)45-36)21-13-16-31(44-39)26-41-25-29-14-7-4-8-15-29/h4-15,17-21,30-32,35-37H,16,22-28H2,1-3H3/t30?,31?,32-,35?,36?,37+,39?,40?/m0/s1 |
| InChIKey | MZMCEYKVGMBDIT-REZSKPRCSA-N |
| XLogP | 6.62 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.97 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|