C33H42O6SSi — CID 134969672
(3aS,6R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-7-phenylmethoxy-6-(sulfanylmethyl)-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6-ol (PubChem CID 134969672) has the molecular formula C33H42O6SSi and a molecular weight of 594.85 g/mol. Its IUPAC name is (3aS,6R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-7-phenylmethoxy-6-(sulfanylmethyl)-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6-ol.
| Compound Name | (3aS,6R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-7-phenylmethoxy-6-(sulfanylmethyl)-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6-ol |
|---|---|
| PubChem CID | 134969672 |
| Molecular Formula | C33H42O6SSi |
| Molecular Weight | 594.85 g/mol |
| Exact Mass | 594.25 |
| IUPAC Name | (3aS,6R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-7-phenylmethoxy-6-(sulfanylmethyl)-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6-ol |
| SMILES | CC1(C)OC2C(OCc3ccccc3)[C@](O)(CS)OC(CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)[C@@H]2O1 |
| InChI | InChI=1S/C33H42O6SSi/c1-31(2,3)41(25-17-11-7-12-18-25,26-19-13-8-14-20-26)36-22-27-28-29(39-32(4,5)38-28)30(33(34,23-40)37-27)35-21-24-15-9-6-10-16-24/h6-20,27-30,34,40H,21-23H2,1-5H3/t27?,28-,29?,30?,33-/m0/s1 |
| InChIKey | MOSHLDQUCHCBCH-MXKREQDASA-N |
| XLogP | 4.69 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.85 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|