C29H40O4Si — CID 11167551
[(2R,3aS,5R,6S,7aS)-5-methoxy-6-methyl-5-prop-2-enyl-2,3,3a,6,7,7a-hexahydrofuro[3,2-b]pyran-2-yl]methoxy-tert-butyl-diphenylsilane (PubChem CID 11167551) has the molecular formula C29H40O4Si and a molecular weight of 480.72 g/mol. Its IUPAC name is [(2R,3aS,5R,6S,7aS)-5-methoxy-6-methyl-5-prop-2-enyl-2,3,3a,6,7,7a-hexahydrofuro[3,2-b]pyran-2-yl]methoxy-tert-butyl-diphenylsilane.
| Compound Name | [(2R,3aS,5R,6S,7aS)-5-methoxy-6-methyl-5-prop-2-enyl-2,3,3a,6,7,7a-hexahydrofuro[3,2-b]pyran-2-yl]methoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 11167551 |
| Molecular Formula | C29H40O4Si |
| Molecular Weight | 480.72 g/mol |
| Exact Mass | 480.27 |
| IUPAC Name | [(2R,3aS,5R,6S,7aS)-5-methoxy-6-methyl-5-prop-2-enyl-2,3,3a,6,7,7a-hexahydrofuro[3,2-b]pyran-2-yl]methoxy-tert-butyl-diphenylsilane |
| SMILES | C=CC[C@@]1(OC)O[C@H]2C[C@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)O[C@H]2C[C@@H]1C |
| InChI | InChI=1S/C29H40O4Si/c1-7-18-29(30-6)22(2)19-26-27(33-29)20-23(32-26)21-31-34(28(3,4)5,24-14-10-8-11-15-24)25-16-12-9-13-17-25/h7-17,22-23,26-27H,1,18-21H2,2-6H3/t22-,23+,26-,27-,29+/m0/s1 |
| InChIKey | OYQPCWFMYXIVOD-HKWSIXNMSA-N |
| XLogP | 5.06 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.72 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|