C20H18F4N2O4 — CID 112500113
2-(2-fluoro-4-methoxyphenoxy)-N-(2-oxopiperidin-4-yl)-5-(trifluoromethyl)benzamide (PubChem CID 112500113) has the molecular formula C20H18F4N2O4 and a molecular weight of 426.37 g/mol. Its IUPAC name is 2-(2-fluoro-4-methoxyphenoxy)-N-(2-oxopiperidin-4-yl)-5-(trifluoromethyl)benzamide.
| Compound Name | 2-(2-fluoro-4-methoxyphenoxy)-N-(2-oxopiperidin-4-yl)-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 112500113 |
| Molecular Formula | C20H18F4N2O4 |
| Molecular Weight | 426.37 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | 2-(2-fluoro-4-methoxyphenoxy)-N-(2-oxopiperidin-4-yl)-5-(trifluoromethyl)benzamide |
| SMILES | COc1ccc(Oc2ccc(C(F)(F)F)cc2C(=O)NC2CCNC(=O)C2)c(F)c1 |
| InChI | InChI=1S/C20H18F4N2O4/c1-29-13-3-5-17(15(21)10-13)30-16-4-2-11(20(22,23)24)8-14(16)19(28)26-12-6-7-25-18(27)9-12/h2-5,8,10,12H,6-7,9H2,1H3,(H,25,27)(H,26,28) |
| InChIKey | QYPAVMFXSXJHOM-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.37 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |