C19H17Cl2FN2O4 — CID 112500169
4,5-dichloro-2-(3-fluoro-4-methoxyphenoxy)-N-(2-oxopiperidin-4-yl)benzamide (PubChem CID 112500169) has the molecular formula C19H17Cl2FN2O4 and a molecular weight of 427.26 g/mol. Its IUPAC name is 4,5-dichloro-2-(3-fluoro-4-methoxyphenoxy)-N-(2-oxopiperidin-4-yl)benzamide.
| Compound Name | 4,5-dichloro-2-(3-fluoro-4-methoxyphenoxy)-N-(2-oxopiperidin-4-yl)benzamide |
|---|---|
| PubChem CID | 112500169 |
| Molecular Formula | C19H17Cl2FN2O4 |
| Molecular Weight | 427.26 g/mol |
| Exact Mass | 426.05 |
| IUPAC Name | 4,5-dichloro-2-(3-fluoro-4-methoxyphenoxy)-N-(2-oxopiperidin-4-yl)benzamide |
| SMILES | COc1ccc(Oc2cc(Cl)c(Cl)cc2C(=O)NC2CCNC(=O)C2)cc1F |
| InChI | InChI=1S/C19H17Cl2FN2O4/c1-27-16-3-2-11(7-15(16)22)28-17-9-14(21)13(20)8-12(17)19(26)24-10-4-5-23-18(25)6-10/h2-3,7-10H,4-6H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | WOVXWKQJFFPFHU-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.26 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |