C19H23F3N2O4 — CID 112500190
2-(cyclopentylmethoxy)-N-(2-oxopiperidin-4-yl)-5-(trifluoromethoxy)benzamide (PubChem CID 112500190) has the molecular formula C19H23F3N2O4 and a molecular weight of 400.40 g/mol. Its IUPAC name is 2-(cyclopentylmethoxy)-N-(2-oxopiperidin-4-yl)-5-(trifluoromethoxy)benzamide.
| Compound Name | 2-(cyclopentylmethoxy)-N-(2-oxopiperidin-4-yl)-5-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 112500190 |
| Molecular Formula | C19H23F3N2O4 |
| Molecular Weight | 400.40 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 2-(cyclopentylmethoxy)-N-(2-oxopiperidin-4-yl)-5-(trifluoromethoxy)benzamide |
| SMILES | O=C1CC(NC(=O)c2cc(OC(F)(F)F)ccc2OCC2CCCC2)CCN1 |
| InChI | InChI=1S/C19H23F3N2O4/c20-19(21,22)28-14-5-6-16(27-11-12-3-1-2-4-12)15(10-14)18(26)24-13-7-8-23-17(25)9-13/h5-6,10,12-13H,1-4,7-9,11H2,(H,23,25)(H,24,26) |
| InChIKey | PPQCOFHAKONULL-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.40 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |