C21H21F3N2O4 — CID 112500121
2-(4-methoxy-2-methylphenoxy)-N-(2-oxopiperidin-4-yl)-5-(trifluoromethyl)benzamide (PubChem CID 112500121) has the molecular formula C21H21F3N2O4 and a molecular weight of 422.40 g/mol. Its IUPAC name is 2-(4-methoxy-2-methylphenoxy)-N-(2-oxopiperidin-4-yl)-5-(trifluoromethyl)benzamide.
| Compound Name | 2-(4-methoxy-2-methylphenoxy)-N-(2-oxopiperidin-4-yl)-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 112500121 |
| Molecular Formula | C21H21F3N2O4 |
| Molecular Weight | 422.40 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | 2-(4-methoxy-2-methylphenoxy)-N-(2-oxopiperidin-4-yl)-5-(trifluoromethyl)benzamide |
| SMILES | COc1ccc(Oc2ccc(C(F)(F)F)cc2C(=O)NC2CCNC(=O)C2)c(C)c1 |
| InChI | InChI=1S/C21H21F3N2O4/c1-12-9-15(29-2)4-6-17(12)30-18-5-3-13(21(22,23)24)10-16(18)20(28)26-14-7-8-25-19(27)11-14/h3-6,9-10,14H,7-8,11H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | SQECQDAJTXAETQ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.40 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |