C29H54N2O6Si2 — CID 11250201
(E)-1-[2,6-bis(2-triethoxysilylethyl)phenyl]-N-piperidin-1-ylethanimine (PubChem CID 11250201) has the molecular formula C29H54N2O6Si2 and a molecular weight of 582.93 g/mol. Its IUPAC name is (E)-1-[2,6-bis(2-triethoxysilylethyl)phenyl]-N-piperidin-1-ylethanimine.
| Compound Name | (E)-1-[2,6-bis(2-triethoxysilylethyl)phenyl]-N-piperidin-1-ylethanimine |
|---|---|
| PubChem CID | 11250201 |
| Molecular Formula | C29H54N2O6Si2 |
| Molecular Weight | 582.93 g/mol |
| Exact Mass | 582.35 |
| IUPAC Name | (E)-1-[2,6-bis(2-triethoxysilylethyl)phenyl]-N-piperidin-1-ylethanimine |
| SMILES | CCO[Si](CCc1cccc(CC[Si](OCC)(OCC)OCC)c1/C(C)=N/N1CCCCC1)(OCC)OCC |
| InChI | InChI=1S/C29H54N2O6Si2/c1-8-32-38(33-9-2,34-10-3)24-20-27-18-17-19-28(21-25-39(35-11-4,36-12-5)37-13-6)29(27)26(7)30-31-22-15-14-16-23-31/h17-19H,8-16,20-25H2,1-7H3/b30-26+ |
| InChIKey | AJPOPBOEZGAAPC-URGPHPNLSA-N |
| XLogP | 6.08 |
| TPSA | 70.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.93 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|