C37H54O9Si — CID 11250924
tert-butyl 2-[(2R,4R,6S)-6-[(Z,6R)-2-hydroxy-4-oxo-7-phenylmethoxy-6-triethylsilyloxyhept-2-enyl]-2-(4-methoxyphenyl)-1,3-dioxan-4-yl]acetate (PubChem CID 11250924) has the molecular formula C37H54O9Si and a molecular weight of 670.92 g/mol. Its IUPAC name is tert-butyl 2-[(2R,4R,6S)-6-[(Z,6R)-2-hydroxy-4-oxo-7-phenylmethoxy-6-triethylsilyloxyhept-2-enyl]-2-(4-methoxyphenyl)-1,3-dioxan-4-yl]acetate.
| Compound Name | tert-butyl 2-[(2R,4R,6S)-6-[(Z,6R)-2-hydroxy-4-oxo-7-phenylmethoxy-6-triethylsilyloxyhept-2-enyl]-2-(4-methoxyphenyl)-1,3-dioxan-4-yl]acetate |
|---|---|
| PubChem CID | 11250924 |
| Molecular Formula | C37H54O9Si |
| Molecular Weight | 670.92 g/mol |
| Exact Mass | 670.35 |
| IUPAC Name | tert-butyl 2-[(2R,4R,6S)-6-[(Z,6R)-2-hydroxy-4-oxo-7-phenylmethoxy-6-triethylsilyloxyhept-2-enyl]-2-(4-methoxyphenyl)-1,3-dioxan-4-yl]acetate |
| SMILES | CC[Si](CC)(CC)O[C@@H](COCc1ccccc1)CC(=O)/C=C(\O)C[C@@H]1C[C@H](CC(=O)OC(C)(C)C)O[C@H](c2ccc(OC)cc2)O1 |
| InChI | InChI=1S/C37H54O9Si/c1-8-47(9-2,10-3)46-34(26-42-25-27-14-12-11-13-15-27)22-30(39)20-29(38)21-32-23-33(24-35(40)45-37(4,5)6)44-36(43-32)28-16-18-31(41-7)19-17-28/h11-20,32-34,36,38H,8-10,21-26H2,1-7H3/b29-20-/t32-,33-,34-,36-/m1/s1 |
| InChIKey | IHPNCOJDAGYCLD-NHLXRDFWSA-N |
| XLogP | 8.00 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.92 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|