C9H9BrF2OS — CID 112560941
1-bromo-3-(3,4-difluorophenyl)sulfanylpropan-2-ol (PubChem CID 112560941) has the molecular formula C9H9BrF2OS and a molecular weight of 283.14 g/mol. Its IUPAC name is 1-bromo-3-(3,4-difluorophenyl)sulfanylpropan-2-ol.
| Compound Name | 1-bromo-3-(3,4-difluorophenyl)sulfanylpropan-2-ol |
|---|---|
| PubChem CID | 112560941 |
| Molecular Formula | C9H9BrF2OS |
| Molecular Weight | 283.14 g/mol |
| Exact Mass | 281.95 |
| IUPAC Name | 1-bromo-3-(3,4-difluorophenyl)sulfanylpropan-2-ol |
| SMILES | OC(CBr)CSc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C9H9BrF2OS/c10-4-6(13)5-14-7-1-2-8(11)9(12)3-7/h1-3,6,13H,4-5H2 |
| InChIKey | OAYSKXPEPXFUOT-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.14 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|