C12H17BrN2O — CID 112571735
5-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-3-bromo-1,2,4-oxadiazole (PubChem CID 112571735) has the molecular formula C12H17BrN2O and a molecular weight of 285.19 g/mol. Its IUPAC name is 5-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-3-bromo-1,2,4-oxadiazole.
| Compound Name | 5-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-3-bromo-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 112571735 |
| Molecular Formula | C12H17BrN2O |
| Molecular Weight | 285.19 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | 5-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-3-bromo-1,2,4-oxadiazole |
| SMILES | Brc1noc(C2CCC3CCCCC3C2)n1 |
| InChI | InChI=1S/C12H17BrN2O/c13-12-14-11(16-15-12)10-6-5-8-3-1-2-4-9(8)7-10/h8-10H,1-7H2 |
| InChIKey | AGIYCUDIRZFQJH-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.19 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |