C11H13N5 — CID 112595336
1-[3-(cyclopropylamino)propyl]imidazole-4,5-dicarbonitrile (PubChem CID 112595336) has the molecular formula C11H13N5 and a molecular weight of 215.26 g/mol. Its IUPAC name is 1-[3-(cyclopropylamino)propyl]imidazole-4,5-dicarbonitrile.
| Compound Name | 1-[3-(cyclopropylamino)propyl]imidazole-4,5-dicarbonitrile |
|---|---|
| PubChem CID | 112595336 |
| Molecular Formula | C11H13N5 |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | 1-[3-(cyclopropylamino)propyl]imidazole-4,5-dicarbonitrile |
| SMILES | N#Cc1ncn(CCCNC2CC2)c1C#N |
| InChI | InChI=1S/C11H13N5/c12-6-10-11(7-13)16(8-15-10)5-1-4-14-9-2-3-9/h8-9,14H,1-5H2 |
| InChIKey | HMQOHWVRCJGZOJ-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|