C13H14N2S — CID 112641294
2-(1,3-thiazol-5-ylmethyl)-2,3-dihydro-1H-inden-1-amine (PubChem CID 112641294) has the molecular formula C13H14N2S and a molecular weight of 230.34 g/mol. Its IUPAC name is 2-(1,3-thiazol-5-ylmethyl)-2,3-dihydro-1H-inden-1-amine.
| Compound Name | 2-(1,3-thiazol-5-ylmethyl)-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 112641294 |
| Molecular Formula | C13H14N2S |
| Molecular Weight | 230.34 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 2-(1,3-thiazol-5-ylmethyl)-2,3-dihydro-1H-inden-1-amine |
| SMILES | NC1c2ccccc2CC1Cc1cncs1 |
| InChI | InChI=1S/C13H14N2S/c14-13-10(6-11-7-15-8-16-11)5-9-3-1-2-4-12(9)13/h1-4,7-8,10,13H,5-6,14H2 |
| InChIKey | JJRWOTBRODEMGS-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.34 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |