C11H13NOS — CID 11264240
(4R)-2-benzylsulfanyl-4-methyl-4,5-dihydro-1,3-oxazole (PubChem CID 11264240) has the molecular formula C11H13NOS and a molecular weight of 207.30 g/mol. Its IUPAC name is (4R)-2-benzylsulfanyl-4-methyl-4,5-dihydro-1,3-oxazole.
| Compound Name | (4R)-2-benzylsulfanyl-4-methyl-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 11264240 |
| Molecular Formula | C11H13NOS |
| Molecular Weight | 207.30 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | (4R)-2-benzylsulfanyl-4-methyl-4,5-dihydro-1,3-oxazole |
| SMILES | C[C@@H]1COC(SCc2ccccc2)=N1 |
| InChI | InChI=1S/C11H13NOS/c1-9-7-13-11(12-9)14-8-10-5-3-2-4-6-10/h2-6,9H,7-8H2,1H3/t9-/m1/s1 |
| InChIKey | VOYAKTDSFHFGTJ-SECBINFHSA-N |
| XLogP | 2.69 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.30 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |