C15H13NO4 — CID 11265719
methyl 1-methyl-4,9-dioxo-2,3-dihydrobenzo[f]indole-3-carboxylate (PubChem CID 11265719) has the molecular formula C15H13NO4 and a molecular weight of 271.27 g/mol. Its IUPAC name is methyl 1-methyl-4,9-dioxo-2,3-dihydrobenzo[f]indole-3-carboxylate.
| Compound Name | methyl 1-methyl-4,9-dioxo-2,3-dihydrobenzo[f]indole-3-carboxylate |
|---|---|
| PubChem CID | 11265719 |
| Molecular Formula | C15H13NO4 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | methyl 1-methyl-4,9-dioxo-2,3-dihydrobenzo[f]indole-3-carboxylate |
| SMILES | COC(=O)C1CN(C)C2=C1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C15H13NO4/c1-16-7-10(15(19)20-2)11-12(16)14(18)9-6-4-3-5-8(9)13(11)17/h3-6,10H,7H2,1-2H3 |
| InChIKey | VCYCPHFYIXXFOJ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|