C23H26O — CID 11267136
(2S,3E,4R)-4-ethenyl-2-phenyl-3-(1-phenylpentylidene)oxolane (PubChem CID 11267136) has the molecular formula C23H26O and a molecular weight of 318.46 g/mol. Its IUPAC name is (2S,3E,4R)-4-ethenyl-2-phenyl-3-(1-phenylpentylidene)oxolane.
| Compound Name | (2S,3E,4R)-4-ethenyl-2-phenyl-3-(1-phenylpentylidene)oxolane |
|---|---|
| PubChem CID | 11267136 |
| Molecular Formula | C23H26O |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.20 |
| IUPAC Name | (2S,3E,4R)-4-ethenyl-2-phenyl-3-(1-phenylpentylidene)oxolane |
| SMILES | C=C[C@H]1CO[C@@H](c2ccccc2)/C1=C(\CCCC)c1ccccc1 |
| InChI | InChI=1S/C23H26O/c1-3-5-16-21(19-12-8-6-9-13-19)22-18(4-2)17-24-23(22)20-14-10-7-11-15-20/h4,6-15,18,23H,2-3,5,16-17H2,1H3/b22-21+/t18-,23-/m0/s1 |
| InChIKey | ZXYLIKJMFCYTQS-DOOZDCQLSA-N |
| XLogP | 6.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|