About 5H-imidazo[4,5-c]pyridazine-6-carbaldehyde
5H-imidazo[4,5-c]pyridazine-6-carbaldehyde (PubChem CID 112710724) has the molecular formula C6H4N4O
and a molecular weight of 148.12 g/mol. Its IUPAC name is 5H-imidazo[4,5-c]pyridazine-6-carbaldehyde.
Molecular Properties
| Compound Name | 5H-imidazo[4,5-c]pyridazine-6-carbaldehyde |
| PubChem CID | 112710724 |
| Molecular Formula | C6H4N4O |
| Molecular Weight | 148.12 g/mol |
| Exact Mass | 148.04 |
| IUPAC Name | 5H-imidazo[4,5-c]pyridazine-6-carbaldehyde |
| SMILES | O=Cc1nc2nnccc2[nH]1 |
| InChI | InChI=1S/C6H4N4O/c11-3-5-8-4-1-2-7-10-6(4)9-5/h1-3H,(H,8,9,10) |
| InChIKey | JTAUJDLQFCWTJR-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.12 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5H-imidazo[4,5-c]pyridazine-6-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5H-imidazo[4,5-c]pyridazine-6-carbaldehyde?
The IUPAC name of 5H-imidazo[4,5-c]pyridazine-6-carbaldehyde (CID 112710724) is 5H-imidazo[4,5-c]pyridazine-6-carbaldehyde.
What is the SMILES notation for 5H-imidazo[4,5-c]pyridazine-6-carbaldehyde?
The canonical SMILES for 5H-imidazo[4,5-c]pyridazine-6-carbaldehyde is O=Cc1nc2nnccc2[nH]1.
What is the InChIKey of 5H-imidazo[4,5-c]pyridazine-6-carbaldehyde?
The InChIKey is JTAUJDLQFCWTJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N4O/c11-3-5-8-4-1-2-7-10-6(4)9-5/h1-3H,(H,8,9,10).
What are the key properties of 5H-imidazo[4,5-c]pyridazine-6-carbaldehyde?
5H-imidazo[4,5-c]pyridazine-6-carbaldehyde has a molecular weight of 148.12 g/mol, XLogP of 0.17, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5H-imidazo[4,5-c]pyridazine-6-carbaldehyde is sourced from PubChem (CID 112710724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).