C9H15NO — CID 112714159
spiro[2,3,3a,4,6,7a-hexahydro-1H-pyrano[4,3-b]pyrrole-7,1'-cyclopropane] (PubChem CID 112714159) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is spiro[2,3,3a,4,6,7a-hexahydro-1H-pyrano[4,3-b]pyrrole-7,1'-cyclopropane].
| Compound Name | spiro[2,3,3a,4,6,7a-hexahydro-1H-pyrano[4,3-b]pyrrole-7,1'-cyclopropane] |
|---|---|
| PubChem CID | 112714159 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | spiro[2,3,3a,4,6,7a-hexahydro-1H-pyrano[4,3-b]pyrrole-7,1'-cyclopropane] |
| SMILES | C1CC2COCC3(CC3)C2N1 |
| InChI | InChI=1S/C9H15NO/c1-4-10-8-7(1)5-11-6-9(8)2-3-9/h7-8,10H,1-6H2 |
| InChIKey | FXHVFVFXTLQTGC-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |