About [3-(4-ethylphenyl)-2-methylpropyl] thiocyanate
[3-(4-ethylphenyl)-2-methylpropyl] thiocyanate (PubChem CID 112717239) has the molecular formula C13H17NS
and a molecular weight of 219.35 g/mol. Its IUPAC name is [3-(4-ethylphenyl)-2-methylpropyl] thiocyanate.
Molecular Properties
| Compound Name | [3-(4-ethylphenyl)-2-methylpropyl] thiocyanate |
| PubChem CID | 112717239 |
| Molecular Formula | C13H17NS |
| Molecular Weight | 219.35 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | [3-(4-ethylphenyl)-2-methylpropyl] thiocyanate |
| SMILES | CCc1ccc(CC(C)CSC#N)cc1 |
| InChI | InChI=1S/C13H17NS/c1-3-12-4-6-13(7-5-12)8-11(2)9-15-10-14/h4-7,11H,3,8-9H2,1-2H3 |
| InChIKey | IUUUEEQCOVKYJW-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.35 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze [3-(4-ethylphenyl)-2-methylpropyl] thiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(4-ethylphenyl)-2-methylpropyl] thiocyanate?
The IUPAC name of [3-(4-ethylphenyl)-2-methylpropyl] thiocyanate (CID 112717239) is [3-(4-ethylphenyl)-2-methylpropyl] thiocyanate.
What is the SMILES notation for [3-(4-ethylphenyl)-2-methylpropyl] thiocyanate?
The canonical SMILES for [3-(4-ethylphenyl)-2-methylpropyl] thiocyanate is CCc1ccc(CC(C)CSC#N)cc1.
What is the InChIKey of [3-(4-ethylphenyl)-2-methylpropyl] thiocyanate?
The InChIKey is IUUUEEQCOVKYJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NS/c1-3-12-4-6-13(7-5-12)8-11(2)9-15-10-14/h4-7,11H,3,8-9H2,1-2H3.
What are the key properties of [3-(4-ethylphenyl)-2-methylpropyl] thiocyanate?
[3-(4-ethylphenyl)-2-methylpropyl] thiocyanate has a molecular weight of 219.35 g/mol, XLogP of 3.64, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(4-ethylphenyl)-2-methylpropyl] thiocyanate is sourced from PubChem (CID 112717239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).