C13H20O4 — CID 112718404
5-(2-hydroxy-3-methoxyphenyl)hexane-2,3-diol (PubChem CID 112718404) has the molecular formula C13H20O4 and a molecular weight of 240.30 g/mol. Its IUPAC name is 5-(2-hydroxy-3-methoxyphenyl)hexane-2,3-diol.
| Compound Name | 5-(2-hydroxy-3-methoxyphenyl)hexane-2,3-diol |
|---|---|
| PubChem CID | 112718404 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 5-(2-hydroxy-3-methoxyphenyl)hexane-2,3-diol |
| SMILES | COc1cccc(C(C)CC(O)C(C)O)c1O |
| InChI | InChI=1S/C13H20O4/c1-8(7-11(15)9(2)14)10-5-4-6-12(17-3)13(10)16/h4-6,8-9,11,14-16H,7H2,1-3H3 |
| InChIKey | OJYQWJZYAWESLQ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |