C12H18N2O2 — CID 112721876
(E)-3-(1,3,5-trimethylpyrazol-4-yl)hex-2-enoic acid (PubChem CID 112721876) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is (E)-3-(1,3,5-trimethylpyrazol-4-yl)hex-2-enoic acid.
| Compound Name | (E)-3-(1,3,5-trimethylpyrazol-4-yl)hex-2-enoic acid |
|---|---|
| PubChem CID | 112721876 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | (E)-3-(1,3,5-trimethylpyrazol-4-yl)hex-2-enoic acid |
| SMILES | CCC/C(=C\C(=O)O)c1c(C)nn(C)c1C |
| InChI | InChI=1S/C12H18N2O2/c1-5-6-10(7-11(15)16)12-8(2)13-14(4)9(12)3/h7H,5-6H2,1-4H3,(H,15,16)/b10-7+ |
| InChIKey | ISJOMIMIJSSKNX-JXMROGBWSA-N |
| XLogP | 2.31 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|