C12H18N2 — CID 143740870
4-[(3Z)-hexa-3,5-dien-3-yl]-1,3,5-trimethylpyrazole (PubChem CID 143740870) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is 4-[(3Z)-hexa-3,5-dien-3-yl]-1,3,5-trimethylpyrazole.
| Compound Name | 4-[(3Z)-hexa-3,5-dien-3-yl]-1,3,5-trimethylpyrazole |
|---|---|
| PubChem CID | 143740870 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | 4-[(3Z)-hexa-3,5-dien-3-yl]-1,3,5-trimethylpyrazole |
| SMILES | C=C/C=C(/CC)c1c(C)nn(C)c1C |
| InChI | InChI=1S/C12H18N2/c1-6-8-11(7-2)12-9(3)13-14(5)10(12)4/h6,8H,1,7H2,2-5H3/b11-8- |
| InChIKey | SISLTPCMIDFLNR-FLIBITNWSA-N |
| XLogP | 3.02 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|