C11H17N3 — CID 143740810
(1E)-N-methyl-1-(1,3,5-trimethylpyrazol-4-yl)buta-1,3-dien-1-amine (PubChem CID 143740810) has the molecular formula C11H17N3 and a molecular weight of 191.28 g/mol. Its IUPAC name is (1E)-N-methyl-1-(1,3,5-trimethylpyrazol-4-yl)buta-1,3-dien-1-amine.
| Compound Name | (1E)-N-methyl-1-(1,3,5-trimethylpyrazol-4-yl)buta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 143740810 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | (1E)-N-methyl-1-(1,3,5-trimethylpyrazol-4-yl)buta-1,3-dien-1-amine |
| SMILES | C=C/C=C(/NC)c1c(C)nn(C)c1C |
| InChI | InChI=1S/C11H17N3/c1-6-7-10(12-4)11-8(2)13-14(5)9(11)3/h6-7,12H,1H2,2-5H3/b10-7+ |
| InChIKey | GFHALNFBFARSLW-JXMROGBWSA-N |
| XLogP | 1.78 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|