C6H11N3OS — CID 129173858
N-hydroxysulfanyl-1,3,5-trimethylpyrazol-4-amine (PubChem CID 129173858) has the molecular formula C6H11N3OS and a molecular weight of 173.24 g/mol. Its IUPAC name is N-hydroxysulfanyl-1,3,5-trimethylpyrazol-4-amine.
| Compound Name | N-hydroxysulfanyl-1,3,5-trimethylpyrazol-4-amine |
|---|---|
| PubChem CID | 129173858 |
| Molecular Formula | C6H11N3OS |
| Molecular Weight | 173.24 g/mol |
| Exact Mass | 173.06 |
| IUPAC Name | N-hydroxysulfanyl-1,3,5-trimethylpyrazol-4-amine |
| SMILES | Cc1nn(C)c(C)c1NSO |
| InChI | InChI=1S/C6H11N3OS/c1-4-6(8-11-10)5(2)9(3)7-4/h8,10H,1-3H3 |
| InChIKey | AGZUIXNRHSBURC-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.24 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|