C8H12N4O3S — CID 112733233
N-(3-methyl-1,1-dioxothiolan-3-yl)-2H-triazole-4-carboxamide (PubChem CID 112733233) has the molecular formula C8H12N4O3S and a molecular weight of 244.28 g/mol. Its IUPAC name is N-(3-methyl-1,1-dioxothiolan-3-yl)-2H-triazole-4-carboxamide.
| Compound Name | N-(3-methyl-1,1-dioxothiolan-3-yl)-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 112733233 |
| Molecular Formula | C8H12N4O3S |
| Molecular Weight | 244.28 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | N-(3-methyl-1,1-dioxothiolan-3-yl)-2H-triazole-4-carboxamide |
| SMILES | CC1(NC(=O)c2cn[nH]n2)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C8H12N4O3S/c1-8(2-3-16(14,15)5-8)10-7(13)6-4-9-12-11-6/h4H,2-3,5H2,1H3,(H,10,13)(H,9,11,12) |
| InChIKey | OJZHOBIAQDQESM-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.28 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |