C12H15N3O3S2 — CID 63748853
5-carbamothioyl-N-(3-methyl-1,1-dioxothiolan-3-yl)pyridine-2-carboxamide (PubChem CID 63748853) has the molecular formula C12H15N3O3S2 and a molecular weight of 313.40 g/mol. Its IUPAC name is 5-carbamothioyl-N-(3-methyl-1,1-dioxothiolan-3-yl)pyridine-2-carboxamide.
| Compound Name | 5-carbamothioyl-N-(3-methyl-1,1-dioxothiolan-3-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 63748853 |
| Molecular Formula | C12H15N3O3S2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | 5-carbamothioyl-N-(3-methyl-1,1-dioxothiolan-3-yl)pyridine-2-carboxamide |
| SMILES | CC1(NC(=O)c2ccc(C(N)=S)cn2)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H15N3O3S2/c1-12(4-5-20(17,18)7-12)15-11(16)9-3-2-8(6-14-9)10(13)19/h2-3,6H,4-5,7H2,1H3,(H2,13,19)(H,15,16) |
| InChIKey | GRIDYYUBCUKZHO-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|