C12H19F3N2 — CID 112737125
1-[[(2S)-piperidin-2-yl]methyl]-4-(trifluoromethyl)-3,6-dihydro-2H-pyridine (PubChem CID 112737125) has the molecular formula C12H19F3N2 and a molecular weight of 248.29 g/mol. Its IUPAC name is 1-[[(2S)-piperidin-2-yl]methyl]-4-(trifluoromethyl)-3,6-dihydro-2H-pyridine.
| Compound Name | 1-[[(2S)-piperidin-2-yl]methyl]-4-(trifluoromethyl)-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 112737125 |
| Molecular Formula | C12H19F3N2 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | 1-[[(2S)-piperidin-2-yl]methyl]-4-(trifluoromethyl)-3,6-dihydro-2H-pyridine |
| SMILES | FC(F)(F)C1=CCN(C[C@@H]2CCCCN2)CC1 |
| InChI | InChI=1S/C12H19F3N2/c13-12(14,15)10-4-7-17(8-5-10)9-11-3-1-2-6-16-11/h4,11,16H,1-3,5-9H2/t11-/m0/s1 |
| InChIKey | FBLCBZGUMWBFFY-NSHDSACASA-N |
| XLogP | 2.32 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|