C41H64O6Si2 — CID 11274042
triethyl-[(2R,3S)-2-[4-[(2S,3R,5S,6R)-5-phenylmethoxy-6-(phenylmethoxymethyl)-3-triethylsilyloxyoxan-2-yl]but-2-ynyl]oxan-3-yl]oxysilane (PubChem CID 11274042) has the molecular formula C41H64O6Si2 and a molecular weight of 709.13 g/mol. Its IUPAC name is triethyl-[(2R,3S)-2-[4-[(2S,3R,5S,6R)-5-phenylmethoxy-6-(phenylmethoxymethyl)-3-triethylsilyloxyoxan-2-yl]but-2-ynyl]oxan-3-yl]oxysilane.
| Compound Name | triethyl-[(2R,3S)-2-[4-[(2S,3R,5S,6R)-5-phenylmethoxy-6-(phenylmethoxymethyl)-3-triethylsilyloxyoxan-2-yl]but-2-ynyl]oxan-3-yl]oxysilane |
|---|---|
| PubChem CID | 11274042 |
| Molecular Formula | C41H64O6Si2 |
| Molecular Weight | 709.13 g/mol |
| Exact Mass | 708.42 |
| IUPAC Name | triethyl-[(2R,3S)-2-[4-[(2S,3R,5S,6R)-5-phenylmethoxy-6-(phenylmethoxymethyl)-3-triethylsilyloxyoxan-2-yl]but-2-ynyl]oxan-3-yl]oxysilane |
| SMILES | CC[Si](CC)(CC)O[C@H]1CCCO[C@@H]1CC#CC[C@@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)C[C@H]1O[Si](CC)(CC)CC |
| InChI | InChI=1S/C41H64O6Si2/c1-7-48(8-2,9-3)46-38-28-21-29-43-36(38)26-19-20-27-37-40(47-49(10-4,11-5)12-6)30-39(44-32-35-24-17-14-18-25-35)41(45-37)33-42-31-34-22-15-13-16-23-34/h13-18,22-25,36-41H,7-12,21,26-33H2,1-6H3/t36-,37+,38+,39+,40-,41-/m1/s1 |
| InChIKey | OKIDGLXWPCCDQM-BFZFGVKUSA-N |
| XLogP | 9.69 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.13 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|