C12H7F2N3S — CID 112750355
4-(3,5-difluorophenyl)thieno[3,2-d]pyrimidin-2-amine (PubChem CID 112750355) has the molecular formula C12H7F2N3S and a molecular weight of 263.27 g/mol. Its IUPAC name is 4-(3,5-difluorophenyl)thieno[3,2-d]pyrimidin-2-amine.
| Compound Name | 4-(3,5-difluorophenyl)thieno[3,2-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 112750355 |
| Molecular Formula | C12H7F2N3S |
| Molecular Weight | 263.27 g/mol |
| Exact Mass | 263.03 |
| IUPAC Name | 4-(3,5-difluorophenyl)thieno[3,2-d]pyrimidin-2-amine |
| SMILES | Nc1nc(-c2cc(F)cc(F)c2)c2sccc2n1 |
| InChI | InChI=1S/C12H7F2N3S/c13-7-3-6(4-8(14)5-7)10-11-9(1-2-18-11)16-12(15)17-10/h1-5H,(H2,15,16,17) |
| InChIKey | CBFKHWMRAFUXAJ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.27 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |