C11H19N3O3S — CID 112751764
2-[2-[(5-piperidin-3-yl-1,3,4-oxadiazol-2-yl)sulfanyl]ethoxy]ethanol (PubChem CID 112751764) has the molecular formula C11H19N3O3S and a molecular weight of 273.36 g/mol. Its IUPAC name is 2-[2-[(5-piperidin-3-yl-1,3,4-oxadiazol-2-yl)sulfanyl]ethoxy]ethanol.
| Compound Name | 2-[2-[(5-piperidin-3-yl-1,3,4-oxadiazol-2-yl)sulfanyl]ethoxy]ethanol |
|---|---|
| PubChem CID | 112751764 |
| Molecular Formula | C11H19N3O3S |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 2-[2-[(5-piperidin-3-yl-1,3,4-oxadiazol-2-yl)sulfanyl]ethoxy]ethanol |
| SMILES | OCCOCCSc1nnc(C2CCCNC2)o1 |
| InChI | InChI=1S/C11H19N3O3S/c15-4-5-16-6-7-18-11-14-13-10(17-11)9-2-1-3-12-8-9/h9,12,15H,1-8H2 |
| InChIKey | ZJVUTRWRYZCNTN-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 80.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|