C15H20F2N2O2S2 — CID 112759116
2-[2-(diethylamino)-2-oxoethyl]sulfanyl-N-[4-(difluoromethylsulfanyl)phenyl]acetamide (PubChem CID 112759116) has the molecular formula C15H20F2N2O2S2 and a molecular weight of 362.47 g/mol. Its IUPAC name is 2-[2-(diethylamino)-2-oxoethyl]sulfanyl-N-[4-(difluoromethylsulfanyl)phenyl]acetamide.
| Compound Name | 2-[2-(diethylamino)-2-oxoethyl]sulfanyl-N-[4-(difluoromethylsulfanyl)phenyl]acetamide |
|---|---|
| PubChem CID | 112759116 |
| Molecular Formula | C15H20F2N2O2S2 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | 2-[2-(diethylamino)-2-oxoethyl]sulfanyl-N-[4-(difluoromethylsulfanyl)phenyl]acetamide |
| SMILES | CCN(CC)C(=O)CSCC(=O)Nc1ccc(SC(F)F)cc1 |
| InChI | InChI=1S/C15H20F2N2O2S2/c1-3-19(4-2)14(21)10-22-9-13(20)18-11-5-7-12(8-6-11)23-15(16)17/h5-8,15H,3-4,9-10H2,1-2H3,(H,18,20) |
| InChIKey | TZMQHPVXYZGMAL-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |