C11H16O5 — CID 11276241
(3S,4S,5S)-4-hydroxy-3-[(E,1S)-1-hydroxy-3-(3-methyloxiran-2-yl)prop-2-enyl]-5-methyloxolan-2-one (PubChem CID 11276241) has the molecular formula C11H16O5 and a molecular weight of 228.24 g/mol. Its IUPAC name is (3S,4S,5S)-4-hydroxy-3-[(E,1S)-1-hydroxy-3-(3-methyloxiran-2-yl)prop-2-enyl]-5-methyloxolan-2-one.
| Compound Name | (3S,4S,5S)-4-hydroxy-3-[(E,1S)-1-hydroxy-3-(3-methyloxiran-2-yl)prop-2-enyl]-5-methyloxolan-2-one |
|---|---|
| PubChem CID | 11276241 |
| Molecular Formula | C11H16O5 |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | (3S,4S,5S)-4-hydroxy-3-[(E,1S)-1-hydroxy-3-(3-methyloxiran-2-yl)prop-2-enyl]-5-methyloxolan-2-one |
| SMILES | CC1OC1/C=C/[C@H](O)[C@@H]1C(=O)O[C@@H](C)[C@H]1O |
| InChI | InChI=1S/C11H16O5/c1-5-8(15-5)4-3-7(12)9-10(13)6(2)16-11(9)14/h3-10,12-13H,1-2H3/b4-3+/t5?,6-,7-,8?,9-,10+/m0/s1 |
| InChIKey | CVZIBBIJVCXJQK-STHNXXGYSA-N |
| XLogP | -0.39 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|