C20H16O2 — CID 11277673
(4S,5R)-4-hydroxyspiro[cyclopent-2-ene-5,15'-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene]-1-one (PubChem CID 11277673) has the molecular formula C20H16O2 and a molecular weight of 288.35 g/mol. Its IUPAC name is (4S,5R)-4-hydroxyspiro[cyclopent-2-ene-5,15'-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene]-1-one.
| Compound Name | (4S,5R)-4-hydroxyspiro[cyclopent-2-ene-5,15'-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene]-1-one |
|---|---|
| PubChem CID | 11277673 |
| Molecular Formula | C20H16O2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | (4S,5R)-4-hydroxyspiro[cyclopent-2-ene-5,15'-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene]-1-one |
| SMILES | O=C1C=C[C@H](O)[C@]12CC1c3ccccc3C2c2ccccc21 |
| InChI | InChI=1S/C20H16O2/c21-17-9-10-18(22)20(17)11-16-12-5-1-3-7-14(12)19(20)15-8-4-2-6-13(15)16/h1-10,16-17,19,21H,11H2/t16?,17-,19?,20+/m0/s1 |
| InChIKey | WSYOUJYZLMBVKP-CAOKTKFFSA-N |
| XLogP | 3.15 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |