C25H30O — CID 11279446
(Z)-3-ethyl-4,5-diphenylundec-4-en-6-yn-3-ol (PubChem CID 11279446) has the molecular formula C25H30O and a molecular weight of 346.51 g/mol. Its IUPAC name is (Z)-3-ethyl-4,5-diphenylundec-4-en-6-yn-3-ol.
| Compound Name | (Z)-3-ethyl-4,5-diphenylundec-4-en-6-yn-3-ol |
|---|---|
| PubChem CID | 11279446 |
| Molecular Formula | C25H30O |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | (Z)-3-ethyl-4,5-diphenylundec-4-en-6-yn-3-ol |
| SMILES | CCCCC#C/C(=C(/c1ccccc1)C(O)(CC)CC)c1ccccc1 |
| InChI | InChI=1S/C25H30O/c1-4-7-8-15-20-23(21-16-11-9-12-17-21)24(25(26,5-2)6-3)22-18-13-10-14-19-22/h9-14,16-19,26H,4-8H2,1-3H3/b24-23+ |
| InChIKey | VXKZHXUSAHWPRT-WCWDXBQESA-N |
| XLogP | 6.34 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|