C22H25ClN2O4S — CID 112810518
[1-(4-chlorophenyl)sulfonylcyclopentyl]-[4-(3-hydroxyphenyl)piperazin-1-yl]methanone (PubChem CID 112810518) has the molecular formula C22H25ClN2O4S and a molecular weight of 448.97 g/mol. Its IUPAC name is [1-(4-chlorophenyl)sulfonylcyclopentyl]-[4-(3-hydroxyphenyl)piperazin-1-yl]methanone.
| Compound Name | [1-(4-chlorophenyl)sulfonylcyclopentyl]-[4-(3-hydroxyphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 112810518 |
| Molecular Formula | C22H25ClN2O4S |
| Molecular Weight | 448.97 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | [1-(4-chlorophenyl)sulfonylcyclopentyl]-[4-(3-hydroxyphenyl)piperazin-1-yl]methanone |
| SMILES | O=C(N1CCN(c2cccc(O)c2)CC1)C1(S(=O)(=O)c2ccc(Cl)cc2)CCCC1 |
| InChI | InChI=1S/C22H25ClN2O4S/c23-17-6-8-20(9-7-17)30(28,29)22(10-1-2-11-22)21(27)25-14-12-24(13-15-25)18-4-3-5-19(26)16-18/h3-9,16,26H,1-2,10-15H2 |
| InChIKey | YCSIXXSINSQFNV-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.97 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |